About 7-aminohept-1-en-2-ol
7-aminohept-1-en-2-ol (PubChem CID 89084096) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 7-aminohept-1-en-2-ol.
Molecular Properties
| Compound Name | 7-aminohept-1-en-2-ol |
| PubChem CID | 89084096 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 7-aminohept-1-en-2-ol |
| SMILES | C=C(O)CCCCCN |
| InChI | InChI=1S/C7H15NO/c1-7(9)5-3-2-4-6-8/h9H,1-6,8H2 |
| InChIKey | ILOUXHBHFJRXLC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-aminohept-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminohept-1-en-2-ol?
The IUPAC name of 7-aminohept-1-en-2-ol (CID 89084096) is 7-aminohept-1-en-2-ol.
What is the SMILES notation for 7-aminohept-1-en-2-ol?
The canonical SMILES for 7-aminohept-1-en-2-ol is C=C(O)CCCCCN.
What is the InChIKey of 7-aminohept-1-en-2-ol?
The InChIKey is ILOUXHBHFJRXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-7(9)5-3-2-4-6-8/h9H,1-6,8H2.
What are the key properties of 7-aminohept-1-en-2-ol?
7-aminohept-1-en-2-ol has a molecular weight of 129.20 g/mol, XLogP of 1.58, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminohept-1-en-2-ol is sourced from PubChem (CID 89084096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).