About 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene
1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene (PubChem CID 89084243) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene |
| PubChem CID | 89084243 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene |
| SMILES | C=CCOC1=CCCC(C)=C1OCC=C |
| InChI | InChI=1S/C13H18O2/c1-4-9-14-12-8-6-7-11(3)13(12)15-10-5-2/h4-5,8H,1-2,6-7,9-10H2,3H3 |
| InChIKey | RNXXOQFTRWMFHA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene?
The IUPAC name of 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene (CID 89084243) is 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene.
What is the SMILES notation for 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene?
The canonical SMILES for 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene is C=CCOC1=CCCC(C)=C1OCC=C.
What is the InChIKey of 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene?
The InChIKey is RNXXOQFTRWMFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-4-9-14-12-8-6-7-11(3)13(12)15-10-5-2/h4-5,8H,1-2,6-7,9-10H2,3H3.
What are the key properties of 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene?
1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene has a molecular weight of 206.28 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-bis(prop-2-enoxy)cyclohexa-1,3-diene is sourced from PubChem (CID 89084243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).