About 4,5-dimethyl-1,3-oxathiole
4,5-dimethyl-1,3-oxathiole (PubChem CID 89084317) has the molecular formula C5H8OS
and a molecular weight of 116.18 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-oxathiole.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,3-oxathiole |
| PubChem CID | 89084317 |
| Molecular Formula | C5H8OS |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.03 |
| IUPAC Name | 4,5-dimethyl-1,3-oxathiole |
| SMILES | CC1=C(C)SCO1 |
| InChI | InChI=1S/C5H8OS/c1-4-5(2)7-3-6-4/h3H2,1-2H3 |
| InChIKey | OSQGPLGZPXXQEH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-1,3-oxathiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,3-oxathiole?
The IUPAC name of 4,5-dimethyl-1,3-oxathiole (CID 89084317) is 4,5-dimethyl-1,3-oxathiole.
What is the SMILES notation for 4,5-dimethyl-1,3-oxathiole?
The canonical SMILES for 4,5-dimethyl-1,3-oxathiole is CC1=C(C)SCO1.
What is the InChIKey of 4,5-dimethyl-1,3-oxathiole?
The InChIKey is OSQGPLGZPXXQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS/c1-4-5(2)7-3-6-4/h3H2,1-2H3.
What are the key properties of 4,5-dimethyl-1,3-oxathiole?
4,5-dimethyl-1,3-oxathiole has a molecular weight of 116.18 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,3-oxathiole is sourced from PubChem (CID 89084317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).