C21H17NO5 — CID 8908474
(2-methoxy-5-nitrophenyl) 2,2-diphenylacetate (PubChem CID 8908474) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (2-methoxy-5-nitrophenyl) 2,2-diphenylacetate.
| Compound Name | (2-methoxy-5-nitrophenyl) 2,2-diphenylacetate |
|---|---|
| PubChem CID | 8908474 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2-methoxy-5-nitrophenyl) 2,2-diphenylacetate |
| SMILES | COc1ccc([N+](=O)[O-])cc1OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17NO5/c1-26-18-13-12-17(22(24)25)14-19(18)27-21(23)20(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14,20H,1H3 |
| InChIKey | RWNCOAACXDDPHO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|