C12H17NO4 — CID 89084896
3-O-ethyl 2-O-prop-1-en-2-yl (1S,3S,5S)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate (PubChem CID 89084896) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-O-ethyl 2-O-prop-1-en-2-yl (1S,3S,5S)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-prop-1-en-2-yl (1S,3S,5S)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 89084896 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-O-ethyl 2-O-prop-1-en-2-yl (1S,3S,5S)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate |
| SMILES | C=C(C)OC(=O)N1[C@H](C(=O)OCC)C[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C12H17NO4/c1-4-16-11(14)10-6-8-5-9(8)13(10)12(15)17-7(2)3/h8-10H,2,4-6H2,1,3H3/t8-,9-,10-/m0/s1 |
| InChIKey | YLLAFDNMYNEYMN-GUBZILKMSA-N |
| XLogP | 1.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|