C15H24O2 — CID 89084950
(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]pentan-1-ol (PubChem CID 89084950) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]pentan-1-ol.
| Compound Name | (4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 89084950 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]pentan-1-ol |
| SMILES | C=CC[C@@H]1C=CC[C@@H](C[C@@H](C)CC(=C)CO)O1 |
| InChI | InChI=1S/C15H24O2/c1-4-6-14-7-5-8-15(17-14)10-12(2)9-13(3)11-16/h4-5,7,12,14-16H,1,3,6,8-11H2,2H3/t12-,14+,15-/m0/s1 |
| InChIKey | ADGKGJXCPVJMKR-CFVMTHIKSA-N |
| XLogP | 3.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|