C15H23BrO2 — CID 89084971
(2R,3S,6R)-2-[4-(bromomethyl)pent-4-enyl]-3-methoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran (PubChem CID 89084971) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is (2R,3S,6R)-2-[4-(bromomethyl)pent-4-enyl]-3-methoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6R)-2-[4-(bromomethyl)pent-4-enyl]-3-methoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 89084971 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (2R,3S,6R)-2-[4-(bromomethyl)pent-4-enyl]-3-methoxy-6-prop-2-enyl-3,6-dihydro-2H-pyran |
| SMILES | C=CC[C@@H]1C=C[C@H](OC)[C@@H](CCCC(=C)CBr)O1 |
| InChI | InChI=1S/C15H23BrO2/c1-4-6-13-9-10-14(17-3)15(18-13)8-5-7-12(2)11-16/h4,9-10,13-15H,1-2,5-8,11H2,3H3/t13-,14+,15-/m1/s1 |
| InChIKey | WBCSNKUONQHSRF-QLFBSQMISA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|