C21H27FN4 — CID 89085334
N-[(5Z,6E)-3-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trien-2-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine (PubChem CID 89085334) has the molecular formula C21H27FN4 and a molecular weight of 354.47 g/mol. Its IUPAC name is N-[(5Z,6E)-3-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trien-2-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine.
| Compound Name | N-[(5Z,6E)-3-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trien-2-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 89085334 |
| Molecular Formula | C21H27FN4 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | N-[(5Z,6E)-3-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trien-2-yl]-6-(aminomethylidene)-5-prop-2-enylidenecyclohexa-1,3-dien-1-yl]piperidin-4-amine |
| SMILES | C=C/C=c1/cc(C(/C=C(/F)C=C)=C/N)cc(NC2CCNCC2)/c1=C/N |
| InChI | InChI=1S/C21H27FN4/c1-3-5-15-10-16(17(13-23)11-18(22)4-2)12-21(20(15)14-24)26-19-6-8-25-9-7-19/h3-5,10-14,19,25-26H,1-2,6-9,23-24H2/b15-5-,17-13+,18-11+,20-14+ |
| InChIKey | IEAWMRMFGSBCOG-PAGVBNITSA-N |
| XLogP | 1.85 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|