C21H27F3N4 — CID 89085364
N-[(5Z,6E)-6-(aminomethylidene)-5-prop-2-enylidene-3-[5-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-3-yl]cyclohexa-1,3-dien-1-yl]piperidin-4-amine (PubChem CID 89085364) has the molecular formula C21H27F3N4 and a molecular weight of 392.47 g/mol. Its IUPAC name is N-[(5Z,6E)-6-(aminomethylidene)-5-prop-2-enylidene-3-[5-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-3-yl]cyclohexa-1,3-dien-1-yl]piperidin-4-amine.
| Compound Name | N-[(5Z,6E)-6-(aminomethylidene)-5-prop-2-enylidene-3-[5-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-3-yl]cyclohexa-1,3-dien-1-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 89085364 |
| Molecular Formula | C21H27F3N4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[(5Z,6E)-6-(aminomethylidene)-5-prop-2-enylidene-3-[5-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-3-yl]cyclohexa-1,3-dien-1-yl]piperidin-4-amine |
| SMILES | C=C/C=c1/cc(C2C=C(C(F)(F)F)CNC2)cc(NC2CCNCC2)/c1=C/N |
| InChI | InChI=1S/C21H27F3N4/c1-2-3-14-8-15(16-9-17(13-27-12-16)21(22,23)24)10-20(19(14)11-25)28-18-4-6-26-7-5-18/h2-3,8-11,16,18,26-28H,1,4-7,12-13,25H2/b14-3-,19-11+ |
| InChIKey | LECGMHWQDBDGEK-SAYNXBTGSA-N |
| XLogP | 1.69 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|