C21H28N4O — CID 89085387
6-[(1E,3E)-1-amino-4-methoxyhexa-1,3,5-trien-2-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine (PubChem CID 89085387) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-[(1E,3E)-1-amino-4-methoxyhexa-1,3,5-trien-2-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine.
| Compound Name | 6-[(1E,3E)-1-amino-4-methoxyhexa-1,3,5-trien-2-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 89085387 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 6-[(1E,3E)-1-amino-4-methoxyhexa-1,3,5-trien-2-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
| SMILES | C=C/C(=C\C(=C/N)c1cc(NC2CCNCC2)c2c(c1)=CCNC=2)OC |
| InChI | InChI=1S/C21H28N4O/c1-3-19(26-2)11-17(13-22)16-10-15-4-7-24-14-20(15)21(12-16)25-18-5-8-23-9-6-18/h3-4,10-14,18,23-25H,1,5-9,22H2,2H3/b17-13+,19-11+ |
| InChIKey | UUDODVJPZNFDMV-AFFUEUAPSA-N |
| XLogP | 0.99 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|