C21H27F3N4 — CID 89085398
6-[(3E,5Z)-6-amino-7,7,7-trifluorohepta-3,5-dien-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine (PubChem CID 89085398) has the molecular formula C21H27F3N4 and a molecular weight of 392.47 g/mol. Its IUPAC name is 6-[(3E,5Z)-6-amino-7,7,7-trifluorohepta-3,5-dien-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine.
| Compound Name | 6-[(3E,5Z)-6-amino-7,7,7-trifluorohepta-3,5-dien-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 89085398 |
| Molecular Formula | C21H27F3N4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 6-[(3E,5Z)-6-amino-7,7,7-trifluorohepta-3,5-dien-3-yl]-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
| SMILES | CC/C(=C\C=C(/N)C(F)(F)F)c1cc(NC2CCNCC2)c2c(c1)=CCNC=2 |
| InChI | InChI=1S/C21H27F3N4/c1-2-14(3-4-20(25)21(22,23)24)16-11-15-5-8-27-13-18(15)19(12-16)28-17-6-9-26-10-7-17/h3-5,11-13,17,26-28H,2,6-10,25H2,1H3/b14-3+,20-4- |
| InChIKey | FBUSLFPNIGZFCS-IQJVSQKQSA-N |
| XLogP | 2.17 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|