C26H38IN5O2 — CID 89085463
N-[(1S,3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-iodo-6-methylpyridine-4-carboxamide (PubChem CID 89085463) has the molecular formula C26H38IN5O2 and a molecular weight of 579.53 g/mol. Its IUPAC name is N-[(1S,3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-iodo-6-methylpyridine-4-carboxamide.
| Compound Name | N-[(1S,3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-iodo-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 89085463 |
| Molecular Formula | C26H38IN5O2 |
| Molecular Weight | 579.53 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | N-[(1S,3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-iodo-6-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2CCC[C@H](C[C@@]3(CCC4CCCCC4)N=C(N)N(C)C3=O)C2)cc(I)n1 |
| InChI | InChI=1S/C26H38IN5O2/c1-17-13-20(15-22(27)29-17)23(33)30-21-10-6-9-19(14-21)16-26(24(34)32(2)25(28)31-26)12-11-18-7-4-3-5-8-18/h13,15,18-19,21H,3-12,14,16H2,1-2H3,(H2,28,31)(H,30,33)/t19-,21-,26+/m0/s1 |
| InChIKey | KMIZALGNZUBBPI-HEKZAOSPSA-N |
| XLogP | 4.56 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|