C7H7ClN2O4 — CID 89085776
(3E,5E)-2-chloro-3,5-dinitrohepta-1,3,5-triene (PubChem CID 89085776) has the molecular formula C7H7ClN2O4 and a molecular weight of 218.60 g/mol. Its IUPAC name is (3E,5E)-2-chloro-3,5-dinitrohepta-1,3,5-triene.
| Compound Name | (3E,5E)-2-chloro-3,5-dinitrohepta-1,3,5-triene |
|---|---|
| PubChem CID | 89085776 |
| Molecular Formula | C7H7ClN2O4 |
| Molecular Weight | 218.60 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | (3E,5E)-2-chloro-3,5-dinitrohepta-1,3,5-triene |
| SMILES | C=C(Cl)/C(=C/C(=C\C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H7ClN2O4/c1-3-6(9(11)12)4-7(5(2)8)10(13)14/h3-4H,2H2,1H3/b6-3+,7-4+ |
| InChIKey | KPGKAQPSIZFQAO-XOKGJFMYSA-N |
| XLogP | 2.08 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.60 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|