About 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine
4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine (PubChem CID 89085950) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine |
| PubChem CID | 89085950 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine |
| SMILES | C=C/C=C(\C(C)CCC)N1CCOCC1 |
| InChI | InChI=1S/C13H23NO/c1-4-6-12(3)13(7-5-2)14-8-10-15-11-9-14/h5,7,12H,2,4,6,8-11H2,1,3H3/b13-7+ |
| InChIKey | HOLWAGBZDISSTH-NTUHNPAUSA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine?
The IUPAC name of 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine (CID 89085950) is 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine.
What is the SMILES notation for 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine?
The canonical SMILES for 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine is C=C/C=C(\C(C)CCC)N1CCOCC1.
What is the InChIKey of 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine?
The InChIKey is HOLWAGBZDISSTH-NTUHNPAUSA-N. The full InChI is InChI=1S/C13H23NO/c1-4-6-12(3)13(7-5-2)14-8-10-15-11-9-14/h5,7,12H,2,4,6,8-11H2,1,3H3/b13-7+.
What are the key properties of 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine?
4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine has a molecular weight of 209.33 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-5-methylocta-1,3-dien-4-yl]morpholine is sourced from PubChem (CID 89085950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).