C17H13B2N3O2S — CID 89085992
CID 89085992 (PubChem CID 89085992) has the molecular formula C17H13B2N3O2S and a molecular weight of 345.00 g/mol.
| Compound Name | CID 89085992 |
|---|---|
| PubChem CID | 89085992 |
| Molecular Formula | C17H13B2N3O2S |
| Molecular Weight | 345.00 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)CSc1nnc([B])n1-c1ccc(C2CC2)c2ccccc12 |
| InChI | InChI=1S/C17H13B2N3O2S/c18-16-20-21-17(25-9-15(23)24-19)22(16)14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14/h1-4,7-8,10H,5-6,9H2 |
| InChIKey | WFAFAZBBWYQWNB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.00 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|