About 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline
2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline (PubChem CID 89086093) has the molecular formula C10H10IN
and a molecular weight of 271.10 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline.
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline |
| PubChem CID | 89086093 |
| Molecular Formula | C10H10IN |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline |
| SMILES | C=C/C=C\c1cccc(I)c1N |
| InChI | InChI=1S/C10H10IN/c1-2-3-5-8-6-4-7-9(11)10(8)12/h2-7H,1,12H2/b5-3- |
| InChIKey | YADFWHJLXQKLMO-HYXAFXHYSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline (CID 89086093) is 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline.
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline is C=C/C=C\c1cccc(I)c1N.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline?
The InChIKey is YADFWHJLXQKLMO-HYXAFXHYSA-N. The full InChI is InChI=1S/C10H10IN/c1-2-3-5-8-6-4-7-9(11)10(8)12/h2-7H,1,12H2/b5-3-.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline?
2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline has a molecular weight of 271.10 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]-6-iodoaniline is sourced from PubChem (CID 89086093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).