C36H32N4 — CID 89086428
(5Z,10Z,14Z,19Z)-15-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-1,2,21,23-tetrahydroporphyrin (PubChem CID 89086428) has the molecular formula C36H32N4 and a molecular weight of 520.68 g/mol. Its IUPAC name is (5Z,10Z,14Z,19Z)-15-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-1,2,21,23-tetrahydroporphyrin.
| Compound Name | (5Z,10Z,14Z,19Z)-15-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-1,2,21,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 89086428 |
| Molecular Formula | C36H32N4 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (5Z,10Z,14Z,19Z)-15-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-1,2,21,23-tetrahydroporphyrin |
| SMILES | Cc1ccc(/C2=c3\cc/c([nH]3)=C/C3=N/C(=C(/c4c(C)cc(C)cc4C)C4=CCC(/C=C5/C=CC2=N5)N4)C=C3)cc1 |
| InChI | InChI=1S/C36H32N4/c1-21-5-7-25(8-6-21)35-30-13-9-26(37-30)19-28-11-15-32(39-28)36(34-23(3)17-22(2)18-24(34)4)33-16-12-29(40-33)20-27-10-14-31(35)38-27/h5-11,13-20,29,37,40H,12H2,1-4H3/b26-19-,27-20-,35-30-,36-32+ |
| InChIKey | LPTWEXMOEHVLOI-AXFAYLPNSA-N |
| XLogP | 5.80 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |