C6H7F5O5S — CID 89086600
1,1,3,3,3-pentafluoro-2-(oxiran-2-ylmethoxy)propane-1-sulfonic acid (PubChem CID 89086600) has the molecular formula C6H7F5O5S and a molecular weight of 286.17 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(oxiran-2-ylmethoxy)propane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(oxiran-2-ylmethoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89086600 |
| Molecular Formula | C6H7F5O5S |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(oxiran-2-ylmethoxy)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(OCC1CO1)C(F)(F)F |
| InChI | InChI=1S/C6H7F5O5S/c7-5(8,9)4(16-2-3-1-15-3)6(10,11)17(12,13)14/h3-4H,1-2H2,(H,12,13,14) |
| InChIKey | IKXVVYVRYYIYHR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|