C20H19N3 — CID 89086835
(1E,3Z)-1-(5-methyl-2-phenylbenzimidazol-1-yl)hexa-1,3,5-trien-1-amine (PubChem CID 89086835) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (1E,3Z)-1-(5-methyl-2-phenylbenzimidazol-1-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-1-(5-methyl-2-phenylbenzimidazol-1-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89086835 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (1E,3Z)-1-(5-methyl-2-phenylbenzimidazol-1-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C=C(/N)n1c(-c2ccccc2)nc2cc(C)ccc21 |
| InChI | InChI=1S/C20H19N3/c1-3-4-6-11-19(21)23-18-13-12-15(2)14-17(18)22-20(23)16-9-7-5-8-10-16/h3-14H,1,21H2,2H3/b6-4-,19-11+ |
| InChIKey | ZUTWJRUTLBIVJX-HDPPBIOQSA-N |
| XLogP | 4.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|