C27H26N2 — CID 89086850
4-cyclohexa-1,3-dien-1-yl-2-N-methyl-5-phenyl-2-N-(1-phenylethenyl)benzene-1,2-diamine (PubChem CID 89086850) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-2-N-methyl-5-phenyl-2-N-(1-phenylethenyl)benzene-1,2-diamine.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-2-N-methyl-5-phenyl-2-N-(1-phenylethenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 89086850 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-2-N-methyl-5-phenyl-2-N-(1-phenylethenyl)benzene-1,2-diamine |
| SMILES | C=C(c1ccccc1)N(C)c1cc(C2=CC=CCC2)c(-c2ccccc2)cc1N |
| InChI | InChI=1S/C27H26N2/c1-20(21-12-6-3-7-13-21)29(2)27-19-25(23-16-10-5-11-17-23)24(18-26(27)28)22-14-8-4-9-15-22/h3-10,12-16,18-19H,1,11,17,28H2,2H3 |
| InChIKey | WPBDNWTVTBGHBB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|