C23H32O2 — CID 89086945
methyl (1R,4aS,10aR)-1,4a,6-trimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate (PubChem CID 89086945) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-1,4a,6-trimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10aR)-1,4a,6-trimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 89086945 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | methyl (1R,4aS,10aR)-1,4a,6-trimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
| SMILES | C=C1C[C@H]2[C@](C)(C(=O)OC)CCC[C@]2(C)c2cc(C)c(C(C)C)cc21 |
| InChI | InChI=1S/C23H32O2/c1-14(2)17-13-18-16(4)12-20-22(5,19(18)11-15(17)3)9-8-10-23(20,6)21(24)25-7/h11,13-14,20H,4,8-10,12H2,1-3,5-7H3/t20-,22-,23-/m1/s1 |
| InChIKey | LNUBDWHZBMLCPE-YMPZKCBVSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |