About 6-butylpyrazin-2-amine
6-butylpyrazin-2-amine (PubChem CID 89087055) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 6-butylpyrazin-2-amine.
Molecular Properties
| Compound Name | 6-butylpyrazin-2-amine |
| PubChem CID | 89087055 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 6-butylpyrazin-2-amine |
| SMILES | CCCCc1cncc(N)n1 |
| InChI | InChI=1S/C8H13N3/c1-2-3-4-7-5-10-6-8(9)11-7/h5-6H,2-4H2,1H3,(H2,9,11) |
| InChIKey | SSSGSAKOARLKQG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-butylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylpyrazin-2-amine?
The IUPAC name of 6-butylpyrazin-2-amine (CID 89087055) is 6-butylpyrazin-2-amine.
What is the SMILES notation for 6-butylpyrazin-2-amine?
The canonical SMILES for 6-butylpyrazin-2-amine is CCCCc1cncc(N)n1.
What is the InChIKey of 6-butylpyrazin-2-amine?
The InChIKey is SSSGSAKOARLKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-3-4-7-5-10-6-8(9)11-7/h5-6H,2-4H2,1H3,(H2,9,11).
What are the key properties of 6-butylpyrazin-2-amine?
6-butylpyrazin-2-amine has a molecular weight of 151.21 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylpyrazin-2-amine is sourced from PubChem (CID 89087055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).