C28H31ClO6S — CID 89087652
[(2S,4R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 89087652) has the molecular formula C28H31ClO6S and a molecular weight of 531.07 g/mol. Its IUPAC name is [(2S,4R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89087652 |
| Molecular Formula | C28H31ClO6S |
| Molecular Weight | 531.07 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | [(2S,4R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCOc1ccc(Cc2cc([C@H]3C[C@@H](O)C[C@@H](COS(=O)(=O)c4ccc(C)cc4)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C28H31ClO6S/c1-3-33-24-9-6-20(7-10-24)14-22-15-21(8-13-27(22)29)28-17-23(30)16-25(35-28)18-34-36(31,32)26-11-4-19(2)5-12-26/h4-13,15,23,25,28,30H,3,14,16-18H2,1-2H3/t23-,25-,28+/m0/s1 |
| InChIKey | FTFIONAGXFAQSN-YRLRHBCXSA-N |
| XLogP | 5.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.07 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|