C9H20N6O5 — CID 89087658
1,3-bis[2-(hydroxymethylcarbamoylamino)ethyl]urea (PubChem CID 89087658) has the molecular formula C9H20N6O5 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1,3-bis[2-(hydroxymethylcarbamoylamino)ethyl]urea.
| Compound Name | 1,3-bis[2-(hydroxymethylcarbamoylamino)ethyl]urea |
|---|---|
| PubChem CID | 89087658 |
| Molecular Formula | C9H20N6O5 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1,3-bis[2-(hydroxymethylcarbamoylamino)ethyl]urea |
| SMILES | O=C(NCO)NCCNC(=O)NCCNC(=O)NCO |
| InChI | InChI=1S/C9H20N6O5/c16-5-14-8(19)12-3-1-10-7(18)11-2-4-13-9(20)15-6-17/h16-17H,1-6H2,(H2,10,11,18)(H2,12,14,19)(H2,13,15,20) |
| InChIKey | CTNVOPGKZMXNAL-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 163.85 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|