C10H20N4S — CID 89087713
N-(1-aminoethyl)-4-(aminomethyl)-N-methyl-1,2,3,6-tetrahydropyridine-5-carbothioamide (PubChem CID 89087713) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is N-(1-aminoethyl)-4-(aminomethyl)-N-methyl-1,2,3,6-tetrahydropyridine-5-carbothioamide.
| Compound Name | N-(1-aminoethyl)-4-(aminomethyl)-N-methyl-1,2,3,6-tetrahydropyridine-5-carbothioamide |
|---|---|
| PubChem CID | 89087713 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-(1-aminoethyl)-4-(aminomethyl)-N-methyl-1,2,3,6-tetrahydropyridine-5-carbothioamide |
| SMILES | CC(N)N(C)C(=S)C1=C(CN)CCNC1 |
| InChI | InChI=1S/C10H20N4S/c1-7(12)14(2)10(15)9-6-13-4-3-8(9)5-11/h7,13H,3-6,11-12H2,1-2H3 |
| InChIKey | YGWBHJZIDVLTML-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|