About 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one
2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one (PubChem CID 89087993) has the molecular formula C7H9FO5
and a molecular weight of 192.14 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one |
| PubChem CID | 89087993 |
| Molecular Formula | C7H9FO5 |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one |
| SMILES | O=C1OC(C(O)CO)C(CF)=C1O |
| InChI | InChI=1S/C7H9FO5/c8-1-3-5(11)7(12)13-6(3)4(10)2-9/h4,6,9-11H,1-2H2 |
| InChIKey | YRMWNKOJHZMXMF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one?
The IUPAC name of 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one (CID 89087993) is 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one.
What is the SMILES notation for 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one?
The canonical SMILES for 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one is O=C1OC(C(O)CO)C(CF)=C1O.
What is the InChIKey of 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one?
The InChIKey is YRMWNKOJHZMXMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FO5/c8-1-3-5(11)7(12)13-6(3)4(10)2-9/h4,6,9-11H,1-2H2.
What are the key properties of 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one?
2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one has a molecular weight of 192.14 g/mol, XLogP of -0.95, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydroxyethyl)-3-(fluoromethyl)-4-hydroxy-2H-furan-5-one is sourced from PubChem (CID 89087993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).