C11H12BF3N2O2 — CID 89088001
5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 89088001) has the molecular formula C11H12BF3N2O2 and a molecular weight of 272.04 g/mol. Its IUPAC name is 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 89088001 |
| Molecular Formula | C11H12BF3N2O2 |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | C=C1OB(c2cnc(N)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C11H12BF3N2O2/c1-6-10(2,3)19-12(18-6)7-4-8(11(13,14)15)9(16)17-5-7/h4-5H,1H2,2-3H3,(H2,16,17) |
| InChIKey | UEDMWKSUWJBXFD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|