C11H17N — CID 89088056
5,7,8-trimethylbicyclo[4.1.1]octa-2,4-dien-2-amine (PubChem CID 89088056) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 5,7,8-trimethylbicyclo[4.1.1]octa-2,4-dien-2-amine.
| Compound Name | 5,7,8-trimethylbicyclo[4.1.1]octa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 89088056 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 5,7,8-trimethylbicyclo[4.1.1]octa-2,4-dien-2-amine |
| SMILES | CC1=CC=C(N)C2C(C)C1C2C |
| InChI | InChI=1S/C11H17N/c1-6-4-5-9(12)11-7(2)10(6)8(11)3/h4-5,7-8,10-11H,12H2,1-3H3 |
| InChIKey | FMPHERFQHOMBAC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |