C21H38F8O5Si — CID 89088104
3-[5,5-difluoro-1-(3,3,5,5,7,7-hexafluorooctoxy)heptan-2-yl]oxypropyl-trimethoxysilane (PubChem CID 89088104) has the molecular formula C21H38F8O5Si and a molecular weight of 550.60 g/mol. Its IUPAC name is 3-[5,5-difluoro-1-(3,3,5,5,7,7-hexafluorooctoxy)heptan-2-yl]oxypropyl-trimethoxysilane.
| Compound Name | 3-[5,5-difluoro-1-(3,3,5,5,7,7-hexafluorooctoxy)heptan-2-yl]oxypropyl-trimethoxysilane |
|---|---|
| PubChem CID | 89088104 |
| Molecular Formula | C21H38F8O5Si |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 3-[5,5-difluoro-1-(3,3,5,5,7,7-hexafluorooctoxy)heptan-2-yl]oxypropyl-trimethoxysilane |
| SMILES | CCC(F)(F)CCC(COCCC(F)(F)CC(F)(F)CC(C)(F)F)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C21H38F8O5Si/c1-6-19(24,25)9-8-17(34-11-7-13-35(30-3,31-4)32-5)14-33-12-10-20(26,27)16-21(28,29)15-18(2,22)23/h17H,6-16H2,1-5H3 |
| InChIKey | VTWUHUDIQHNDIO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|