C19H36F6O5Si — CID 89088106
3-[5,5-difluoro-1-(3,3,5,5-tetrafluorohexoxy)heptan-2-yl]oxypropyl-trimethoxysilane (PubChem CID 89088106) has the molecular formula C19H36F6O5Si and a molecular weight of 486.57 g/mol. Its IUPAC name is 3-[5,5-difluoro-1-(3,3,5,5-tetrafluorohexoxy)heptan-2-yl]oxypropyl-trimethoxysilane.
| Compound Name | 3-[5,5-difluoro-1-(3,3,5,5-tetrafluorohexoxy)heptan-2-yl]oxypropyl-trimethoxysilane |
|---|---|
| PubChem CID | 89088106 |
| Molecular Formula | C19H36F6O5Si |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 3-[5,5-difluoro-1-(3,3,5,5-tetrafluorohexoxy)heptan-2-yl]oxypropyl-trimethoxysilane |
| SMILES | CCC(F)(F)CCC(COCCC(F)(F)CC(C)(F)F)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C19H36F6O5Si/c1-6-18(22,23)9-8-16(30-11-7-13-31(26-3,27-4)28-5)14-29-12-10-19(24,25)15-17(2,20)21/h16H,6-15H2,1-5H3 |
| InChIKey | LROKTJMXCJMIHG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|