C25H38FNO6 — CID 89088230
benzyl N-[(4S,8S)-8-[(2S,3S)-4,4-dimethoxy-3-methyloxolan-2-yl]-8-fluoro-6,7-dimethyl-3-oxooctan-4-yl]carbamate (PubChem CID 89088230) has the molecular formula C25H38FNO6 and a molecular weight of 467.58 g/mol. Its IUPAC name is benzyl N-[(4S,8S)-8-[(2S,3S)-4,4-dimethoxy-3-methyloxolan-2-yl]-8-fluoro-6,7-dimethyl-3-oxooctan-4-yl]carbamate.
| Compound Name | benzyl N-[(4S,8S)-8-[(2S,3S)-4,4-dimethoxy-3-methyloxolan-2-yl]-8-fluoro-6,7-dimethyl-3-oxooctan-4-yl]carbamate |
|---|---|
| PubChem CID | 89088230 |
| Molecular Formula | C25H38FNO6 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | benzyl N-[(4S,8S)-8-[(2S,3S)-4,4-dimethoxy-3-methyloxolan-2-yl]-8-fluoro-6,7-dimethyl-3-oxooctan-4-yl]carbamate |
| SMILES | CCC(=O)[C@H](CC(C)C(C)[C@H](F)[C@H]1OCC(OC)(OC)[C@H]1C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H38FNO6/c1-7-21(28)20(27-24(29)32-14-19-11-9-8-10-12-19)13-16(2)17(3)22(26)23-18(4)25(30-5,31-6)15-33-23/h8-12,16-18,20,22-23H,7,13-15H2,1-6H3,(H,27,29)/t16?,17?,18-,20-,22-,23-/m0/s1 |
| InChIKey | LUZKJFNHGOQARJ-SCAGKHQGSA-N |
| XLogP | 4.28 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|