C10H17F4NO — CID 89088323
N-methyl-1-(1,1,2,2-tetrafluoroethoxy)hept-6-en-3-amine (PubChem CID 89088323) has the molecular formula C10H17F4NO and a molecular weight of 243.24 g/mol. Its IUPAC name is N-methyl-1-(1,1,2,2-tetrafluoroethoxy)hept-6-en-3-amine.
| Compound Name | N-methyl-1-(1,1,2,2-tetrafluoroethoxy)hept-6-en-3-amine |
|---|---|
| PubChem CID | 89088323 |
| Molecular Formula | C10H17F4NO |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-methyl-1-(1,1,2,2-tetrafluoroethoxy)hept-6-en-3-amine |
| SMILES | C=CCCC(CCOC(F)(F)C(F)F)NC |
| InChI | InChI=1S/C10H17F4NO/c1-3-4-5-8(15-2)6-7-16-10(13,14)9(11)12/h3,8-9,15H,1,4-7H2,2H3 |
| InChIKey | MKPSCLMTUWKOBL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|