C13H14N4O — CID 89088351
6-amino-N-[(4-aminophenyl)methyl]pyridine-3-carboxamide (PubChem CID 89088351) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 6-amino-N-[(4-aminophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-amino-N-[(4-aminophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89088351 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 6-amino-N-[(4-aminophenyl)methyl]pyridine-3-carboxamide |
| SMILES | Nc1ccc(CNC(=O)c2ccc(N)nc2)cc1 |
| InChI | InChI=1S/C13H14N4O/c14-11-4-1-9(2-5-11)7-17-13(18)10-3-6-12(15)16-8-10/h1-6,8H,7,14H2,(H2,15,16)(H,17,18) |
| InChIKey | XVKFNTBNKRMAEY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|