C15H25NO — CID 89088362
6-[(5Z)-2-methoxy-5-methylocta-1,5-dien-4-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 89088362) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-[(5Z)-2-methoxy-5-methylocta-1,5-dien-4-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-[(5Z)-2-methoxy-5-methylocta-1,5-dien-4-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 89088362 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 6-[(5Z)-2-methoxy-5-methylocta-1,5-dien-4-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | C=C(CC(/C(C)=C\CC)C1C=CCCN1)OC |
| InChI | InChI=1S/C15H25NO/c1-5-8-12(2)14(11-13(3)17-4)15-9-6-7-10-16-15/h6,8-9,14-16H,3,5,7,10-11H2,1-2,4H3/b12-8- |
| InChIKey | XMXZDYMEYBRYSI-WQLSENKSSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|