C10H15N — CID 89088710
(2E,4Z,5Z)-4-ethylideneocta-2,5,7-trien-3-amine (PubChem CID 89088710) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (2E,4Z,5Z)-4-ethylideneocta-2,5,7-trien-3-amine.
| Compound Name | (2E,4Z,5Z)-4-ethylideneocta-2,5,7-trien-3-amine |
|---|---|
| PubChem CID | 89088710 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (2E,4Z,5Z)-4-ethylideneocta-2,5,7-trien-3-amine |
| SMILES | C=C/C=C\C(=C\C)\C(N)=C/C |
| InChI | InChI=1S/C10H15N/c1-4-7-8-9(5-2)10(11)6-3/h4-8H,1,11H2,2-3H3/b8-7-,9-5-,10-6+ |
| InChIKey | LCHRKSJYWCANOK-HPVYWINVSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|