About 2-fluoro-1-iodo-3,4-dimethylcyclopentane
2-fluoro-1-iodo-3,4-dimethylcyclopentane (PubChem CID 89088711) has the molecular formula C7H12FI
and a molecular weight of 242.07 g/mol. Its IUPAC name is 2-fluoro-1-iodo-3,4-dimethylcyclopentane.
Molecular Properties
| Compound Name | 2-fluoro-1-iodo-3,4-dimethylcyclopentane |
| PubChem CID | 89088711 |
| Molecular Formula | C7H12FI |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 2-fluoro-1-iodo-3,4-dimethylcyclopentane |
| SMILES | CC1CC(I)C(F)C1C |
| InChI | InChI=1S/C7H12FI/c1-4-3-6(9)7(8)5(4)2/h4-7H,3H2,1-2H3 |
| InChIKey | RLXOVQNXVYDQHZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1-iodo-3,4-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-iodo-3,4-dimethylcyclopentane?
The IUPAC name of 2-fluoro-1-iodo-3,4-dimethylcyclopentane (CID 89088711) is 2-fluoro-1-iodo-3,4-dimethylcyclopentane.
What is the SMILES notation for 2-fluoro-1-iodo-3,4-dimethylcyclopentane?
The canonical SMILES for 2-fluoro-1-iodo-3,4-dimethylcyclopentane is CC1CC(I)C(F)C1C.
What is the InChIKey of 2-fluoro-1-iodo-3,4-dimethylcyclopentane?
The InChIKey is RLXOVQNXVYDQHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FI/c1-4-3-6(9)7(8)5(4)2/h4-7H,3H2,1-2H3.
What are the key properties of 2-fluoro-1-iodo-3,4-dimethylcyclopentane?
2-fluoro-1-iodo-3,4-dimethylcyclopentane has a molecular weight of 242.07 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-iodo-3,4-dimethylcyclopentane is sourced from PubChem (CID 89088711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).