C20H28O3 — CID 89088966
(17S)-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde (PubChem CID 89088966) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (17S)-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde.
| Compound Name | (17S)-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde |
|---|---|
| PubChem CID | 89088966 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (17S)-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@@H]2C=O |
| InChI | InChI=1S/C20H28O3/c1-19-8-7-14(22)9-12(19)3-5-15-16-6-4-13(11-21)20(16,2)10-17(23)18(15)19/h9,11,13,15-18,23H,3-8,10H2,1-2H3/t13-,15?,16?,17?,18?,19?,20?/m1/s1 |
| InChIKey | PKXVSTBHGBNOSO-YRUMMAOCSA-N |
| XLogP | 3.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|