C20H36O — CID 89089065
(4Z,6Z)-7-ethenyl-6-methoxy-2,2,3,8-tetramethyl-5-propan-2-yldeca-4,6-diene (PubChem CID 89089065) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (4Z,6Z)-7-ethenyl-6-methoxy-2,2,3,8-tetramethyl-5-propan-2-yldeca-4,6-diene.
| Compound Name | (4Z,6Z)-7-ethenyl-6-methoxy-2,2,3,8-tetramethyl-5-propan-2-yldeca-4,6-diene |
|---|---|
| PubChem CID | 89089065 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (4Z,6Z)-7-ethenyl-6-methoxy-2,2,3,8-tetramethyl-5-propan-2-yldeca-4,6-diene |
| SMILES | C=C/C(=C(OC)\C(=C/C(C)C(C)(C)C)C(C)C)C(C)CC |
| InChI | InChI=1S/C20H36O/c1-11-15(5)17(12-2)19(21-10)18(14(3)4)13-16(6)20(7,8)9/h12-16H,2,11H2,1,3-10H3/b18-13-,19-17- |
| InChIKey | XTEKJRVOPINCTK-MAFYCXDASA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|