About 1,2-dimethylpyrazine
1,2-dimethylpyrazine (PubChem CID 89089115) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 1,2-dimethylpyrazine.
Molecular Properties
| Compound Name | 1,2-dimethylpyrazine |
| PubChem CID | 89089115 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 1,2-dimethylpyrazine |
| SMILES | CC1=CN=C=CN1C |
| InChI | InChI=1S/C6H8N2/c1-6-5-7-3-4-8(6)2/h4-5H,1-2H3 |
| InChIKey | GCGNRKRTBMUFMZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpyrazine?
The IUPAC name of 1,2-dimethylpyrazine (CID 89089115) is 1,2-dimethylpyrazine.
What is the SMILES notation for 1,2-dimethylpyrazine?
The canonical SMILES for 1,2-dimethylpyrazine is CC1=CN=C=CN1C.
What is the InChIKey of 1,2-dimethylpyrazine?
The InChIKey is GCGNRKRTBMUFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-6-5-7-3-4-8(6)2/h4-5H,1-2H3.
What are the key properties of 1,2-dimethylpyrazine?
1,2-dimethylpyrazine has a molecular weight of 108.14 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpyrazine is sourced from PubChem (CID 89089115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).