C23H30N4O5S3 — CID 89089400
N-[(E)-3-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,19,20-triazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]prop-2-enyl]-2-sulfanylacetamide (PubChem CID 89089400) has the molecular formula C23H30N4O5S3 and a molecular weight of 538.72 g/mol. Its IUPAC name is N-[(E)-3-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,19,20-triazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]prop-2-enyl]-2-sulfanylacetamide.
| Compound Name | N-[(E)-3-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,19,20-triazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]prop-2-enyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 89089400 |
| Molecular Formula | C23H30N4O5S3 |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | N-[(E)-3-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,19,20-triazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]prop-2-enyl]-2-sulfanylacetamide |
| SMILES | CC(C)C1NC(=O)[C@]2(C)CSC(=N2)c2csc(n2)CCC(=O)CC(/C=C/CNC(=O)CS)OC1=O |
| InChI | InChI=1S/C23H30N4O5S3/c1-13(2)19-21(30)32-15(5-4-8-24-17(29)10-33)9-14(28)6-7-18-25-16(11-34-18)20-27-23(3,12-35-20)22(31)26-19/h4-5,11,13,15,19,33H,6-10,12H2,1-3H3,(H,24,29)(H,26,31)/b5-4+/t15?,19?,23-/m0/s1 |
| InChIKey | CPEZHJWJIJALSG-IHEOMDHOSA-N |
| XLogP | 1.96 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|