C20H22FN2O+ — CID 8908953
(3-fluorophenyl)methyl-methyl-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]azanium (PubChem CID 8908953) has the molecular formula C20H22FN2O+ and a molecular weight of 325.41 g/mol. Its IUPAC name is (3-fluorophenyl)methyl-methyl-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]azanium.
| Compound Name | (3-fluorophenyl)methyl-methyl-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8908953 |
| Molecular Formula | C20H22FN2O+ |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (3-fluorophenyl)methyl-methyl-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]azanium |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@H](C)[NH+](C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H21FN2O/c1-13-19(17-9-4-5-10-18(17)22-13)20(24)14(2)23(3)12-15-7-6-8-16(21)11-15/h4-11,14,22H,12H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | PANLXBJEHVAPEW-AWEZNQCLSA-O |
| XLogP | 2.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |