C45H58O4P2 — CID 89089639
[3-ethoxy-4-(2,4,10-tritert-butyl-8-prop-1-en-2-ylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutyl]-diphenylphosphane (PubChem CID 89089639) has the molecular formula C45H58O4P2 and a molecular weight of 724.90 g/mol. Its IUPAC name is [3-ethoxy-4-(2,4,10-tritert-butyl-8-prop-1-en-2-ylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutyl]-diphenylphosphane.
| Compound Name | [3-ethoxy-4-(2,4,10-tritert-butyl-8-prop-1-en-2-ylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutyl]-diphenylphosphane |
|---|---|
| PubChem CID | 89089639 |
| Molecular Formula | C45H58O4P2 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.38 |
| IUPAC Name | [3-ethoxy-4-(2,4,10-tritert-butyl-8-prop-1-en-2-ylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutyl]-diphenylphosphane |
| SMILES | C=C(C)c1cc(C(C)(C)C)cc2c1op(OCC(CCP(c1ccccc1)c1ccccc1)OCC)oc1c(C(C)(C)C)cc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C45H58O4P2/c1-13-46-34(24-25-50(35-20-16-14-17-21-35)36-22-18-15-19-23-36)30-47-51-48-41-37(31(2)3)26-32(43(4,5)6)27-38(41)39-28-33(44(7,8)9)29-40(42(39)49-51)45(10,11)12/h14-23,26-29,34H,2,13,24-25,30H2,1,3-12H3 |
| InChIKey | QXRITVOSFNLJIG-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|