C42H28N6O4S — CID 89089700
4-[5,6-dinitro-4-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]-N,N-diphenylaniline (PubChem CID 89089700) has the molecular formula C42H28N6O4S and a molecular weight of 712.79 g/mol. Its IUPAC name is 4-[5,6-dinitro-4-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]-N,N-diphenylaniline.
| Compound Name | 4-[5,6-dinitro-4-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 89089700 |
| Molecular Formula | C42H28N6O4S |
| Molecular Weight | 712.79 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | 4-[5,6-dinitro-4-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]-N,N-diphenylaniline |
| SMILES | O=[N+]([O-])c1c([N+](=O)[O-])c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c2nsnc2c1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H28N6O4S/c49-47(50)41-37(29-21-25-35(26-22-29)45(31-13-5-1-6-14-31)32-15-7-2-8-16-32)39-40(44-53-43-39)38(42(41)48(51)52)30-23-27-36(28-24-30)46(33-17-9-3-10-18-33)34-19-11-4-12-20-34/h1-28H |
| InChIKey | ZRUAGKLIZMJSQZ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 118.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.79 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|