C14H34F6N6O4P6 — CID 89090006
2,4,6,8,10,12-hexafluoro-2,4-dimethyl-6,8,10,12-tetrapropoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene (PubChem CID 89090006) has the molecular formula C14H34F6N6O4P6 and a molecular weight of 650.30 g/mol. Its IUPAC name is 2,4,6,8,10,12-hexafluoro-2,4-dimethyl-6,8,10,12-tetrapropoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene.
| Compound Name | 2,4,6,8,10,12-hexafluoro-2,4-dimethyl-6,8,10,12-tetrapropoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 89090006 |
| Molecular Formula | C14H34F6N6O4P6 |
| Molecular Weight | 650.30 g/mol |
| Exact Mass | 650.10 |
| IUPAC Name | 2,4,6,8,10,12-hexafluoro-2,4-dimethyl-6,8,10,12-tetrapropoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
| SMILES | CCCOP1(F)=NP(C)(F)=NP(C)(F)=NP(F)(OCCC)=NP(F)(OCCC)=NP(F)(OCCC)=N1 |
| InChI | InChI=1S/C14H34F6N6O4P6/c1-7-11-27-33(17)22-31(5,15)21-32(6,16)23-34(18,28-12-8-2)25-36(20,30-14-10-4)26-35(19,24-33)29-13-9-3/h7-14H2,1-6H3 |
| InChIKey | ZJDNIYJKVYANCP-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 111.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.30 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|