C27H39BrF4N2O4 — CID 89090285
tert-butyl (4S)-4-[(4S)-4-(4-bromophenyl)-5,5,5-trifluoro-4-[[(2S)-4-fluoro-4-methyl-1-oxopentan-2-yl]amino]pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 89090285) has the molecular formula C27H39BrF4N2O4 and a molecular weight of 611.52 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(4S)-4-(4-bromophenyl)-5,5,5-trifluoro-4-[[(2S)-4-fluoro-4-methyl-1-oxopentan-2-yl]amino]pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(4S)-4-(4-bromophenyl)-5,5,5-trifluoro-4-[[(2S)-4-fluoro-4-methyl-1-oxopentan-2-yl]amino]pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 89090285 |
| Molecular Formula | C27H39BrF4N2O4 |
| Molecular Weight | 611.52 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | tert-butyl (4S)-4-[(4S)-4-(4-bromophenyl)-5,5,5-trifluoro-4-[[(2S)-4-fluoro-4-methyl-1-oxopentan-2-yl]amino]pentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(F)C[C@@H](C=O)N[C@@](CCC[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H39BrF4N2O4/c1-23(2,3)38-22(36)34-21(17-37-25(34,6)7)9-8-14-26(27(30,31)32,18-10-12-19(28)13-11-18)33-20(16-35)15-24(4,5)29/h10-13,16,20-21,33H,8-9,14-15,17H2,1-7H3/t20-,21-,26-/m0/s1 |
| InChIKey | WLAFJSDSRQWTLO-WOVHNISZSA-N |
| XLogP | 7.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|