C19H36O3S — CID 89090425
S-methyl (2R,4S,6R,8R,10R,11R)-11-hydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate (PubChem CID 89090425) has the molecular formula C19H36O3S and a molecular weight of 344.56 g/mol. Its IUPAC name is S-methyl (2R,4S,6R,8R,10R,11R)-11-hydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate.
| Compound Name | S-methyl (2R,4S,6R,8R,10R,11R)-11-hydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate |
|---|---|
| PubChem CID | 89090425 |
| Molecular Formula | C19H36O3S |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | S-methyl (2R,4S,6R,8R,10R,11R)-11-hydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate |
| SMILES | CC[C@@H](O)[C@H](C)C[C@@H](C)C(=O)[C@H](C)C[C@H](C)C[C@@H](C)C(=O)SC |
| InChI | InChI=1S/C19H36O3S/c1-8-17(20)13(3)11-15(5)18(21)14(4)9-12(2)10-16(6)19(22)23-7/h12-17,20H,8-11H2,1-7H3/t12-,13+,14+,15+,16+,17+/m0/s1 |
| InChIKey | YRGLOKQMLGEYIO-XXJXLTMMSA-N |
| XLogP | 4.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|