C18H26O4 — CID 89090845
(4R,5R)-4-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-5-[(E)-prop-1-enyl]-1,3-dioxolane (PubChem CID 89090845) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (4R,5R)-4-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-5-[(E)-prop-1-enyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-5-[(E)-prop-1-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 89090845 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (4R,5R)-4-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-5-[(E)-prop-1-enyl]-1,3-dioxolane |
| SMILES | C/C=C/[C@H]1OC(C)(C)O[C@@H]1CC#CC#CCOC(C)(C)OC |
| InChI | InChI=1S/C18H26O4/c1-7-12-15-16(22-18(4,5)21-15)13-10-8-9-11-14-20-17(2,3)19-6/h7,12,15-16H,13-14H2,1-6H3/b12-7+/t15-,16-/m1/s1 |
| InChIKey | OQJOCYRHOFXJCK-PWEFJHHISA-N |
| XLogP | 2.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|