C19H27N3O2 — CID 89090857
N-[(2E,4Z)-2-cyclohexa-1,5-dien-1-ylhexa-2,4-dienyl]-N-[(1-ethyl-5-oxoimidazolidin-2-yl)methyl]formamide (PubChem CID 89090857) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[(2E,4Z)-2-cyclohexa-1,5-dien-1-ylhexa-2,4-dienyl]-N-[(1-ethyl-5-oxoimidazolidin-2-yl)methyl]formamide.
| Compound Name | N-[(2E,4Z)-2-cyclohexa-1,5-dien-1-ylhexa-2,4-dienyl]-N-[(1-ethyl-5-oxoimidazolidin-2-yl)methyl]formamide |
|---|---|
| PubChem CID | 89090857 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[(2E,4Z)-2-cyclohexa-1,5-dien-1-ylhexa-2,4-dienyl]-N-[(1-ethyl-5-oxoimidazolidin-2-yl)methyl]formamide |
| SMILES | C/C=C\C=C(\CN(C=O)CC1NCC(=O)N1CC)C1=CCCC=C1 |
| InChI | InChI=1S/C19H27N3O2/c1-3-5-9-17(16-10-7-6-8-11-16)13-21(15-23)14-18-20-12-19(24)22(18)4-2/h3,5,7,9-11,15,18,20H,4,6,8,12-14H2,1-2H3/b5-3-,17-9- |
| InChIKey | XBDUPZNAJPAQGC-WALZVQGWSA-N |
| XLogP | 2.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|