C25H24F6N2O2 — CID 89091096
(5R,8S)-8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one (PubChem CID 89091096) has the molecular formula C25H24F6N2O2 and a molecular weight of 498.47 g/mol. Its IUPAC name is (5R,8S)-8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one.
| Compound Name | (5R,8S)-8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one |
|---|---|
| PubChem CID | 89091096 |
| Molecular Formula | C25H24F6N2O2 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (5R,8S)-8-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one |
| SMILES | CC(OC[C@@]1(c2ccccc2)C=C[C@]2(CCC(=O)N2)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F6N2O2/c1-16(17-11-19(24(26,27)28)13-20(12-17)25(29,30)31)35-15-23(18-5-3-2-4-6-18)10-9-22(14-32-23)8-7-21(34)33-22/h2-6,9-13,16,32H,7-8,14-15H2,1H3,(H,33,34)/t16?,22-,23-/m1/s1 |
| InChIKey | HRPHKEMFKKYTGQ-OWBZPZHYSA-N |
| XLogP | 5.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|