About (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine
(2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine (PubChem CID 89091133) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine |
| PubChem CID | 89091133 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine |
| SMILES | CCC1C=C(C)C(F)=N[C@H]1C |
| InChI | InChI=1S/C9H14FN/c1-4-8-5-6(2)9(10)11-7(8)3/h5,7-8H,4H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | MLXWPSGPJLWYEC-JAMMHHFISA-N |
| XLogP | 2.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine?
The IUPAC name of (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine (CID 89091133) is (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine.
What is the SMILES notation for (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine?
The canonical SMILES for (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine is CCC1C=C(C)C(F)=N[C@H]1C.
What is the InChIKey of (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine?
The InChIKey is MLXWPSGPJLWYEC-JAMMHHFISA-N. The full InChI is InChI=1S/C9H14FN/c1-4-8-5-6(2)9(10)11-7(8)3/h5,7-8H,4H2,1-3H3/t7-,8?/m0/s1.
What are the key properties of (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine?
(2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine has a molecular weight of 155.22 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-ethyl-6-fluoro-2,5-dimethyl-2,3-dihydropyridine is sourced from PubChem (CID 89091133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).